| Name | Benzoylmalonicaciddiethlyester |
| Synonyms | DIETHYL BENZOYLMALONATE DIETHYL 2-BENZOYLMALONATE diethyl benzoylpropanedioate Benzoylmalonicaciddiethlyester BENZOYLMALONIC ACID DIETHYL ESTER Benzoylmalonic acid diethly ester 2-Benzoylmalonic acid diethyl ester Benzoylpropanedioic acid diethyl ester |
| CAS | 1087-97-4 |
| InChI | InChI=1/C14H16O5/c1-3-18-13(16)11(14(17)19-4-2)12(15)10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
| Molecular Formula | C14H16O5 |
| Molar Mass | 264.27 |
| Density | 1,15 g/cm3 |
| Melting Point | 166° |
| Boling Point | 195°C 14mm |
| Flash Point | 142.3°C |
| Vapor Presure | 0.00016mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Light yellow to Light orange |
| pKa | 7.00±0.59(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.5070-1.5100 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| Hazard Class | IRRITANT |